C23H25FIN7O2 — CID 135470855
2-ethoxy-4-[(E)-[[4-(4-fluoroanilino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-iodophenol (PubChem CID 135470855) has the molecular formula C23H25FIN7O2 and a molecular weight of 577.40 g/mol. Its IUPAC name is 2-ethoxy-4-[(E)-[[4-(4-fluoroanilino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-iodophenol.
| Compound Name | 2-ethoxy-4-[(E)-[[4-(4-fluoroanilino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-iodophenol |
|---|---|
| PubChem CID | 135470855 |
| Molecular Formula | C23H25FIN7O2 |
| Molecular Weight | 577.40 g/mol |
| Exact Mass | 577.11 |
| IUPAC Name | 2-ethoxy-4-[(E)-[[4-(4-fluoroanilino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-iodophenol |
| SMILES | CCOc1cc(/C=N/Nc2nc(Nc3ccc(F)cc3)nc(N3CCCCC3)n2)cc(I)c1O |
| InChI | InChI=1S/C23H25FIN7O2/c1-2-34-19-13-15(12-18(25)20(19)33)14-26-31-22-28-21(27-17-8-6-16(24)7-9-17)29-23(30-22)32-10-4-3-5-11-32/h6-9,12-14,33H,2-5,10-11H2,1H3,(H2,27,28,29,30,31)/b26-14+ |
| InChIKey | XUVGHCPXHNVOHZ-VULFUBBASA-N |
| XLogP | 4.90 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|