C21H22FN7O — CID 5335333
3-[(E)-[[4-(4-fluoroanilino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol (PubChem CID 5335333) has the molecular formula C21H22FN7O and a molecular weight of 407.45 g/mol. Its IUPAC name is 3-[(E)-[[4-(4-fluoroanilino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 3-[(E)-[[4-(4-fluoroanilino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 5335333 |
| Molecular Formula | C21H22FN7O |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 3-[(E)-[[4-(4-fluoroanilino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
| SMILES | Oc1cccc(/C=N/Nc2nc(Nc3ccc(F)cc3)nc(N3CCCCC3)n2)c1 |
| InChI | InChI=1S/C21H22FN7O/c22-16-7-9-17(10-8-16)24-19-25-20(27-21(26-19)29-11-2-1-3-12-29)28-23-14-15-5-4-6-18(30)13-15/h4-10,13-14,30H,1-3,11-12H2,(H2,24,25,26,27,28)/b23-14+ |
| InChIKey | OWTSNJVRUONOGR-OEAKJJBVSA-N |
| XLogP | 3.90 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|