C22H35NO2 — CID 90774811
1-[3-hydroxy-10,13-dimethyl-17-(methylamino)-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 90774811) has the molecular formula C22H35NO2 and a molecular weight of 345.53 g/mol. Its IUPAC name is 1-[3-hydroxy-10,13-dimethyl-17-(methylamino)-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[3-hydroxy-10,13-dimethyl-17-(methylamino)-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 90774811 |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | 1-[3-hydroxy-10,13-dimethyl-17-(methylamino)-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CNC1(C(C)=O)CCC2C3CCC4=CC(O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C22H35NO2/c1-14(24)22(23-4)12-9-19-17-6-5-15-13-16(25)7-10-20(15,2)18(17)8-11-21(19,22)3/h13,16-19,23,25H,5-12H2,1-4H3 |
| InChIKey | HIGNTPZRWPMBFF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|