C23H32O4 — CID 87751489
[(3S,8R,9S,10R,13S,14S,16R,17R)-17-ethynyl-3,17-dihydroxy-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-yl] acetate (PubChem CID 87751489) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S,16R,17R)-17-ethynyl-3,17-dihydroxy-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-yl] acetate.
| Compound Name | [(3S,8R,9S,10R,13S,14S,16R,17R)-17-ethynyl-3,17-dihydroxy-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-yl] acetate |
|---|---|
| PubChem CID | 87751489 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S,16R,17R)-17-ethynyl-3,17-dihydroxy-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-yl] acetate |
| SMILES | C#C[C@]1(O)[C@H](OC(C)=O)C[C@H]2[C@@H]3CCC4=C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C23H32O4/c1-5-23(26)20(27-14(2)24)13-19-17-7-6-15-12-16(25)8-10-21(15,3)18(17)9-11-22(19,23)4/h1,12,16-20,25-26H,6-11,13H2,2-4H3/t16-,17+,18-,19-,20+,21-,22-,23-/m0/s1 |
| InChIKey | FDNFACXUVVKKCO-LXGBQXIBSA-N |
| XLogP | 3.22 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|