C26H30F3N3O4 — CID 90775843
2'-amino-2-(2,2-dimethyloxan-4-yl)-3'-methyl-6-[5-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]spiro[2,3-dihydrochromene-4,5'-imidazole]-4'-one (PubChem CID 90775843) has the molecular formula C26H30F3N3O4 and a molecular weight of 505.54 g/mol. Its IUPAC name is 2'-amino-2-(2,2-dimethyloxan-4-yl)-3'-methyl-6-[5-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]spiro[2,3-dihydrochromene-4,5'-imidazole]-4'-one.
| Compound Name | 2'-amino-2-(2,2-dimethyloxan-4-yl)-3'-methyl-6-[5-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]spiro[2,3-dihydrochromene-4,5'-imidazole]-4'-one |
|---|---|
| PubChem CID | 90775843 |
| Molecular Formula | C26H30F3N3O4 |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 2'-amino-2-(2,2-dimethyloxan-4-yl)-3'-methyl-6-[5-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]spiro[2,3-dihydrochromene-4,5'-imidazole]-4'-one |
| SMILES | C=CC(=CC(=C)OC(F)(F)F)c1ccc2c(c1)C1(CC(C3CCOC(C)(C)C3)O2)N=C(N)N(C)C1=O |
| InChI | InChI=1S/C26H30F3N3O4/c1-6-16(11-15(2)36-26(27,28)29)17-7-8-20-19(12-17)25(22(33)32(5)23(30)31-25)14-21(35-20)18-9-10-34-24(3,4)13-18/h6-8,11-12,18,21H,1-2,9-10,13-14H2,3-5H3,(H2,30,31) |
| InChIKey | KOYKAYSDJPSWSS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|