C32H44N2O3 — CID 90776934
tert-butyl N-[[4-hexyl-2-(2-methylpropyl)-6-phenylmethoxyquinolin-3-yl]methyl]carbamate (PubChem CID 90776934) has the molecular formula C32H44N2O3 and a molecular weight of 504.72 g/mol. Its IUPAC name is tert-butyl N-[[4-hexyl-2-(2-methylpropyl)-6-phenylmethoxyquinolin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-hexyl-2-(2-methylpropyl)-6-phenylmethoxyquinolin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 90776934 |
| Molecular Formula | C32H44N2O3 |
| Molecular Weight | 504.72 g/mol |
| Exact Mass | 504.34 |
| IUPAC Name | tert-butyl N-[[4-hexyl-2-(2-methylpropyl)-6-phenylmethoxyquinolin-3-yl]methyl]carbamate |
| SMILES | CCCCCCc1c(CNC(=O)OC(C)(C)C)c(CC(C)C)nc2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C32H44N2O3/c1-7-8-9-13-16-26-27-20-25(36-22-24-14-11-10-12-15-24)17-18-29(27)34-30(19-23(2)3)28(26)21-33-31(35)37-32(4,5)6/h10-12,14-15,17-18,20,23H,7-9,13,16,19,21-22H2,1-6H3,(H,33,35) |
| InChIKey | ZTYQPBPUUVQUAV-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.72 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|