C35H38N2O3 — CID 68829911
2-[[4-hexyl-2-(2-methylpropyl)-6-phenylmethoxyquinolin-3-yl]methyl]isoindole-1,3-dione (PubChem CID 68829911) has the molecular formula C35H38N2O3 and a molecular weight of 534.70 g/mol. Its IUPAC name is 2-[[4-hexyl-2-(2-methylpropyl)-6-phenylmethoxyquinolin-3-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-hexyl-2-(2-methylpropyl)-6-phenylmethoxyquinolin-3-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 68829911 |
| Molecular Formula | C35H38N2O3 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.29 |
| IUPAC Name | 2-[[4-hexyl-2-(2-methylpropyl)-6-phenylmethoxyquinolin-3-yl]methyl]isoindole-1,3-dione |
| SMILES | CCCCCCc1c(CN2C(=O)c3ccccc3C2=O)c(CC(C)C)nc2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C35H38N2O3/c1-4-5-6-10-15-27-30-21-26(40-23-25-13-8-7-9-14-25)18-19-32(30)36-33(20-24(2)3)31(27)22-37-34(38)28-16-11-12-17-29(28)35(37)39/h7-9,11-14,16-19,21,24H,4-6,10,15,20,22-23H2,1-3H3 |
| InChIKey | SVCSIHRTIYTPBP-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|