C15H16O7 — CID 90778128
4-(4-ethoxycarbonyl-2-methoxyphenoxy)-2-methylidene-4-oxobutanoic acid (PubChem CID 90778128) has the molecular formula C15H16O7 and a molecular weight of 308.29 g/mol. Its IUPAC name is 4-(4-ethoxycarbonyl-2-methoxyphenoxy)-2-methylidene-4-oxobutanoic acid.
| Compound Name | 4-(4-ethoxycarbonyl-2-methoxyphenoxy)-2-methylidene-4-oxobutanoic acid |
|---|---|
| PubChem CID | 90778128 |
| Molecular Formula | C15H16O7 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 4-(4-ethoxycarbonyl-2-methoxyphenoxy)-2-methylidene-4-oxobutanoic acid |
| SMILES | C=C(CC(=O)Oc1ccc(C(=O)OCC)cc1OC)C(=O)O |
| InChI | InChI=1S/C15H16O7/c1-4-21-15(19)10-5-6-11(12(8-10)20-3)22-13(16)7-9(2)14(17)18/h5-6,8H,2,4,7H2,1,3H3,(H,17,18) |
| InChIKey | HEGALRIQENSPEZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|