C28H24FN7O4 — CID 90778571
carbamoyl 4-[4-amino-3-(8-fluoro-2-phenoxyquinolin-7-yl)pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexane-1-carboxylate (PubChem CID 90778571) has the molecular formula C28H24FN7O4 and a molecular weight of 541.54 g/mol. Its IUPAC name is carbamoyl 4-[4-amino-3-(8-fluoro-2-phenoxyquinolin-7-yl)pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexane-1-carboxylate.
| Compound Name | carbamoyl 4-[4-amino-3-(8-fluoro-2-phenoxyquinolin-7-yl)pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 90778571 |
| Molecular Formula | C28H24FN7O4 |
| Molecular Weight | 541.54 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | carbamoyl 4-[4-amino-3-(8-fluoro-2-phenoxyquinolin-7-yl)pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexane-1-carboxylate |
| SMILES | NC(=O)OC(=O)C1CCC(n2nc(-c3ccc4ccc(Oc5ccccc5)nc4c3F)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C28H24FN7O4/c29-22-19(12-8-15-9-13-20(34-23(15)22)39-18-4-2-1-3-5-18)24-21-25(30)32-14-33-26(21)36(35-24)17-10-6-16(7-11-17)27(37)40-28(31)38/h1-5,8-9,12-14,16-17H,6-7,10-11H2,(H2,31,38)(H2,30,32,33) |
| InChIKey | GRIKIICRYLFKQF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 161.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|