C17H30N2O4 — CID 90779727
prop-2-enyl 4-(heptan-2-ylamino)-4-oxo-2-(propanoylamino)butanoate (PubChem CID 90779727) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is prop-2-enyl 4-(heptan-2-ylamino)-4-oxo-2-(propanoylamino)butanoate.
| Compound Name | prop-2-enyl 4-(heptan-2-ylamino)-4-oxo-2-(propanoylamino)butanoate |
|---|---|
| PubChem CID | 90779727 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | prop-2-enyl 4-(heptan-2-ylamino)-4-oxo-2-(propanoylamino)butanoate |
| SMILES | C=CCOC(=O)C(CC(=O)NC(C)CCCCC)NC(=O)CC |
| InChI | InChI=1S/C17H30N2O4/c1-5-8-9-10-13(4)18-16(21)12-14(19-15(20)7-3)17(22)23-11-6-2/h6,13-14H,2,5,7-12H2,1,3-4H3,(H,18,21)(H,19,20) |
| InChIKey | LZDJJAOYUMBHSQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|