C15H15N3O3S — CID 9077978
2-(2-oxo-1-pyridinyl)-N'-(2-phenylsulfanylacetyl)acetohydrazide (PubChem CID 9077978) has the molecular formula C15H15N3O3S and a molecular weight of 317.37 g/mol. Its IUPAC name is 2-(2-oxo-1-pyridinyl)-N'-(2-phenylsulfanylacetyl)acetohydrazide.
| Compound Name | 2-(2-oxo-1-pyridinyl)-N'-(2-phenylsulfanylacetyl)acetohydrazide |
|---|---|
| PubChem CID | 9077978 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 2-(2-oxo-1-pyridinyl)-N'-(2-phenylsulfanylacetyl)acetohydrazide |
| SMILES | O=C(CSc1ccccc1)NNC(=O)Cn1ccccc1=O |
| InChI | InChI=1S/C15H15N3O3S/c19-13(10-18-9-5-4-8-15(18)21)16-17-14(20)11-22-12-6-2-1-3-7-12/h1-9H,10-11H2,(H,16,19)(H,17,20) |
| InChIKey | MVTBMTDBGIEYCR-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|