C16H16FN3O3S — CID 9078072
3-(4-fluorophenyl)sulfanyl-N'-[2-(2-oxo-1-pyridinyl)acetyl]propanehydrazide (PubChem CID 9078072) has the molecular formula C16H16FN3O3S and a molecular weight of 349.39 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfanyl-N'-[2-(2-oxo-1-pyridinyl)acetyl]propanehydrazide.
| Compound Name | 3-(4-fluorophenyl)sulfanyl-N'-[2-(2-oxo-1-pyridinyl)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 9078072 |
| Molecular Formula | C16H16FN3O3S |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 3-(4-fluorophenyl)sulfanyl-N'-[2-(2-oxo-1-pyridinyl)acetyl]propanehydrazide |
| SMILES | O=C(CCSc1ccc(F)cc1)NNC(=O)Cn1ccccc1=O |
| InChI | InChI=1S/C16H16FN3O3S/c17-12-4-6-13(7-5-12)24-10-8-14(21)18-19-15(22)11-20-9-2-1-3-16(20)23/h1-7,9H,8,10-11H2,(H,18,21)(H,19,22) |
| InChIKey | TXTBBCKYZDOQES-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|