C14H16FN3O3S — CID 9157027
N'-[2-(2-fluorophenyl)sulfanylacetyl]-2-(2-oxopyrrolidin-1-yl)acetohydrazide (PubChem CID 9157027) has the molecular formula C14H16FN3O3S and a molecular weight of 325.37 g/mol. Its IUPAC name is N'-[2-(2-fluorophenyl)sulfanylacetyl]-2-(2-oxopyrrolidin-1-yl)acetohydrazide.
| Compound Name | N'-[2-(2-fluorophenyl)sulfanylacetyl]-2-(2-oxopyrrolidin-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 9157027 |
| Molecular Formula | C14H16FN3O3S |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | N'-[2-(2-fluorophenyl)sulfanylacetyl]-2-(2-oxopyrrolidin-1-yl)acetohydrazide |
| SMILES | O=C(CSc1ccccc1F)NNC(=O)CN1CCCC1=O |
| InChI | InChI=1S/C14H16FN3O3S/c15-10-4-1-2-5-11(10)22-9-13(20)17-16-12(19)8-18-7-3-6-14(18)21/h1-2,4-5H,3,6-9H2,(H,16,19)(H,17,20) |
| InChIKey | XSHPNFBLVHVKBK-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|