C19H18FN3O3S — CID 9417918
(E)-N-[2-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]-3-phenylprop-2-enamide (PubChem CID 9417918) has the molecular formula C19H18FN3O3S and a molecular weight of 387.44 g/mol. Its IUPAC name is (E)-N-[2-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 9417918 |
| Molecular Formula | C19H18FN3O3S |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | (E)-N-[2-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NCC(=O)NNC(=O)CSc1ccccc1F |
| InChI | InChI=1S/C19H18FN3O3S/c20-15-8-4-5-9-16(15)27-13-19(26)23-22-18(25)12-21-17(24)11-10-14-6-2-1-3-7-14/h1-11H,12-13H2,(H,21,24)(H,22,25)(H,23,26)/b11-10+ |
| InChIKey | QUWXIWRDDFYBBI-ZHACJKMWSA-N |
| XLogP | 1.89 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|