C31H36N2Si2 — CID 90780530
trimethyl-[2-[2-[1-phenyl-5-[2-(4-trimethylsilylphenyl)ethenyl]pyrazol-3-yl]ethenyl]phenyl]silane (PubChem CID 90780530) has the molecular formula C31H36N2Si2 and a molecular weight of 492.82 g/mol. Its IUPAC name is trimethyl-[2-[2-[1-phenyl-5-[2-(4-trimethylsilylphenyl)ethenyl]pyrazol-3-yl]ethenyl]phenyl]silane.
| Compound Name | trimethyl-[2-[2-[1-phenyl-5-[2-(4-trimethylsilylphenyl)ethenyl]pyrazol-3-yl]ethenyl]phenyl]silane |
|---|---|
| PubChem CID | 90780530 |
| Molecular Formula | C31H36N2Si2 |
| Molecular Weight | 492.82 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | trimethyl-[2-[2-[1-phenyl-5-[2-(4-trimethylsilylphenyl)ethenyl]pyrazol-3-yl]ethenyl]phenyl]silane |
| SMILES | C[Si](C)(C)c1ccc(C=Cc2cc(C=Cc3ccccc3[Si](C)(C)C)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H36N2Si2/c1-34(2,3)30-22-17-25(18-23-30)16-21-29-24-27(32-33(29)28-13-8-7-9-14-28)20-19-26-12-10-11-15-31(26)35(4,5)6/h7-24H,1-6H3 |
| InChIKey | MLVFVHMACNFEJS-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.82 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|