C26H25N3O — CID 57080412
4-[2-[5-(4-methoxyphenyl)-1-phenylpyrazol-3-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 57080412) has the molecular formula C26H25N3O and a molecular weight of 395.51 g/mol. Its IUPAC name is 4-[2-[5-(4-methoxyphenyl)-1-phenylpyrazol-3-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-[5-(4-methoxyphenyl)-1-phenylpyrazol-3-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 57080412 |
| Molecular Formula | C26H25N3O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 4-[2-[5-(4-methoxyphenyl)-1-phenylpyrazol-3-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | COc1ccc(-c2cc(C=Cc3ccc(N(C)C)cc3)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H25N3O/c1-28(2)23-15-10-20(11-16-23)9-14-22-19-26(21-12-17-25(30-3)18-13-21)29(27-22)24-7-5-4-6-8-24/h4-19H,1-3H3 |
| InChIKey | HIKABOZUIUFHGP-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|