C21H19N3S — CID 102187147
N,N-dimethyl-4-(1-phenyl-3-thiophen-3-ylpyrazol-5-yl)aniline (PubChem CID 102187147) has the molecular formula C21H19N3S and a molecular weight of 345.47 g/mol. Its IUPAC name is N,N-dimethyl-4-(1-phenyl-3-thiophen-3-ylpyrazol-5-yl)aniline.
| Compound Name | N,N-dimethyl-4-(1-phenyl-3-thiophen-3-ylpyrazol-5-yl)aniline |
|---|---|
| PubChem CID | 102187147 |
| Molecular Formula | C21H19N3S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | N,N-dimethyl-4-(1-phenyl-3-thiophen-3-ylpyrazol-5-yl)aniline |
| SMILES | CN(C)c1ccc(-c2cc(-c3ccsc3)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H19N3S/c1-23(2)18-10-8-16(9-11-18)21-14-20(17-12-13-25-15-17)22-24(21)19-6-4-3-5-7-19/h3-15H,1-2H3 |
| InChIKey | WMDRNSHHRKHZGN-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |