C31H36N2O6 — CID 90782436
3-[[1-(4,4-dimethyl-2,6-dioxocyclohexyl)-3-methylbutylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (PubChem CID 90782436) has the molecular formula C31H36N2O6 and a molecular weight of 532.64 g/mol. Its IUPAC name is 3-[[1-(4,4-dimethyl-2,6-dioxocyclohexyl)-3-methylbutylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-[[1-(4,4-dimethyl-2,6-dioxocyclohexyl)-3-methylbutylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 90782436 |
| Molecular Formula | C31H36N2O6 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 3-[[1-(4,4-dimethyl-2,6-dioxocyclohexyl)-3-methylbutylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| SMILES | CC(C)C/C(=N\CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)C1C(=O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C31H36N2O6/c1-18(2)13-24(28-26(34)14-31(3,4)15-27(28)35)32-16-25(29(36)37)33-30(38)39-17-23-21-11-7-5-9-19(21)20-10-6-8-12-22(20)23/h5-12,18,23,25,28H,13-17H2,1-4H3,(H,33,38)(H,36,37)/b32-24+ |
| InChIKey | ACNPNVSICVRDAL-FEZSWGLMSA-N |
| XLogP | 5.04 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|