C17H16FN3O4 — CID 9078335
(E)-3-(3-fluoro-4-methoxyphenyl)-N'-[2-(2-oxo-1-pyridinyl)acetyl]prop-2-enehydrazide (PubChem CID 9078335) has the molecular formula C17H16FN3O4 and a molecular weight of 345.33 g/mol. Its IUPAC name is (E)-3-(3-fluoro-4-methoxyphenyl)-N'-[2-(2-oxo-1-pyridinyl)acetyl]prop-2-enehydrazide.
| Compound Name | (E)-3-(3-fluoro-4-methoxyphenyl)-N'-[2-(2-oxo-1-pyridinyl)acetyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 9078335 |
| Molecular Formula | C17H16FN3O4 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | (E)-3-(3-fluoro-4-methoxyphenyl)-N'-[2-(2-oxo-1-pyridinyl)acetyl]prop-2-enehydrazide |
| SMILES | COc1ccc(/C=C/C(=O)NNC(=O)Cn2ccccc2=O)cc1F |
| InChI | InChI=1S/C17H16FN3O4/c1-25-14-7-5-12(10-13(14)18)6-8-15(22)19-20-16(23)11-21-9-3-2-4-17(21)24/h2-10H,11H2,1H3,(H,19,22)(H,20,23)/b8-6+ |
| InChIKey | XZCDMGAIFAIJMA-SOFGYWHQSA-N |
| XLogP | 0.86 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|