C16H22FN3O2S — CID 9150304
1-[[(E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoyl]amino]-3-(3-methylbutyl)thiourea (PubChem CID 9150304) has the molecular formula C16H22FN3O2S and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-[[(E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoyl]amino]-3-(3-methylbutyl)thiourea.
| Compound Name | 1-[[(E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoyl]amino]-3-(3-methylbutyl)thiourea |
|---|---|
| PubChem CID | 9150304 |
| Molecular Formula | C16H22FN3O2S |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 1-[[(E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoyl]amino]-3-(3-methylbutyl)thiourea |
| SMILES | COc1ccc(/C=C/C(=O)NNC(=S)NCCC(C)C)cc1F |
| InChI | InChI=1S/C16H22FN3O2S/c1-11(2)8-9-18-16(23)20-19-15(21)7-5-12-4-6-14(22-3)13(17)10-12/h4-7,10-11H,8-9H2,1-3H3,(H,19,21)(H2,18,20,23)/b7-5+ |
| InChIKey | OFLWKZIGRWEFPN-FNORWQNLSA-N |
| XLogP | 2.39 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|