C17H25N3OS — CID 9150368
1-[[(E)-3-(4-ethylphenyl)prop-2-enoyl]amino]-3-(3-methylbutyl)thiourea (PubChem CID 9150368) has the molecular formula C17H25N3OS and a molecular weight of 319.47 g/mol. Its IUPAC name is 1-[[(E)-3-(4-ethylphenyl)prop-2-enoyl]amino]-3-(3-methylbutyl)thiourea.
| Compound Name | 1-[[(E)-3-(4-ethylphenyl)prop-2-enoyl]amino]-3-(3-methylbutyl)thiourea |
|---|---|
| PubChem CID | 9150368 |
| Molecular Formula | C17H25N3OS |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 1-[[(E)-3-(4-ethylphenyl)prop-2-enoyl]amino]-3-(3-methylbutyl)thiourea |
| SMILES | CCc1ccc(/C=C/C(=O)NNC(=S)NCCC(C)C)cc1 |
| InChI | InChI=1S/C17H25N3OS/c1-4-14-5-7-15(8-6-14)9-10-16(21)19-20-17(22)18-12-11-13(2)3/h5-10,13H,4,11-12H2,1-3H3,(H,19,21)(H2,18,20,22)/b10-9+ |
| InChIKey | BHSCIFQTUZPFSV-MDZDMXLPSA-N |
| XLogP | 2.80 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|