C23H23NO5 — CID 90784667
2-[3-[2-[1-(5-phenylfuran-2-yl)prop-1-enylamino]oxyethoxy]phenyl]acetic acid (PubChem CID 90784667) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-[3-[2-[1-(5-phenylfuran-2-yl)prop-1-enylamino]oxyethoxy]phenyl]acetic acid.
| Compound Name | 2-[3-[2-[1-(5-phenylfuran-2-yl)prop-1-enylamino]oxyethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 90784667 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 2-[3-[2-[1-(5-phenylfuran-2-yl)prop-1-enylamino]oxyethoxy]phenyl]acetic acid |
| SMILES | CC=C(NOCCOc1cccc(CC(=O)O)c1)c1ccc(-c2ccccc2)o1 |
| InChI | InChI=1S/C23H23NO5/c1-2-20(22-12-11-21(29-22)18-8-4-3-5-9-18)24-28-14-13-27-19-10-6-7-17(15-19)16-23(25)26/h2-12,15,24H,13-14,16H2,1H3,(H,25,26) |
| InChIKey | GTRNAGJWDPAIGR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|