C25H24ClNO4 — CID 91402800
2-[3-[2-[1-[4-(2-chlorophenyl)phenyl]prop-1-enylamino]oxyethoxy]phenyl]acetic acid (PubChem CID 91402800) has the molecular formula C25H24ClNO4 and a molecular weight of 437.92 g/mol. Its IUPAC name is 2-[3-[2-[1-[4-(2-chlorophenyl)phenyl]prop-1-enylamino]oxyethoxy]phenyl]acetic acid.
| Compound Name | 2-[3-[2-[1-[4-(2-chlorophenyl)phenyl]prop-1-enylamino]oxyethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 91402800 |
| Molecular Formula | C25H24ClNO4 |
| Molecular Weight | 437.92 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 2-[3-[2-[1-[4-(2-chlorophenyl)phenyl]prop-1-enylamino]oxyethoxy]phenyl]acetic acid |
| SMILES | CC=C(NOCCOc1cccc(CC(=O)O)c1)c1ccc(-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C25H24ClNO4/c1-2-24(20-12-10-19(11-13-20)22-8-3-4-9-23(22)26)27-31-15-14-30-21-7-5-6-18(16-21)17-25(28)29/h2-13,16,27H,14-15,17H2,1H3,(H,28,29) |
| InChIKey | TWFSDSCINSQQIB-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.92 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|