C35H47N5O4 — CID 90785580
(2S)-2-[[2-ethylbutyl-(2-imidazol-1-ylacetyl)amino]-(4-methylpentanoyl)amino]-5-phenyl-N-phenylmethoxypent-4-enamide (PubChem CID 90785580) has the molecular formula C35H47N5O4 and a molecular weight of 601.79 g/mol. Its IUPAC name is (2S)-2-[[2-ethylbutyl-(2-imidazol-1-ylacetyl)amino]-(4-methylpentanoyl)amino]-5-phenyl-N-phenylmethoxypent-4-enamide.
| Compound Name | (2S)-2-[[2-ethylbutyl-(2-imidazol-1-ylacetyl)amino]-(4-methylpentanoyl)amino]-5-phenyl-N-phenylmethoxypent-4-enamide |
|---|---|
| PubChem CID | 90785580 |
| Molecular Formula | C35H47N5O4 |
| Molecular Weight | 601.79 g/mol |
| Exact Mass | 601.36 |
| IUPAC Name | (2S)-2-[[2-ethylbutyl-(2-imidazol-1-ylacetyl)amino]-(4-methylpentanoyl)amino]-5-phenyl-N-phenylmethoxypent-4-enamide |
| SMILES | CCC(CC)CN(C(=O)Cn1ccnc1)N(C(=O)CCC(C)C)[C@@H](CC=Cc1ccccc1)C(=O)NOCc1ccccc1 |
| InChI | InChI=1S/C35H47N5O4/c1-5-29(6-2)24-39(34(42)25-38-23-22-36-27-38)40(33(41)21-20-28(3)4)32(19-13-18-30-14-9-7-10-15-30)35(43)37-44-26-31-16-11-8-12-17-31/h7-18,22-23,27-29,32H,5-6,19-21,24-26H2,1-4H3,(H,37,43)/t32-/m0/s1 |
| InChIKey | NVVJLBCBQZGMHO-YTTGMZPUSA-N |
| XLogP | 6.05 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.79 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|