C44H91N7O3 — CID 90785659
3-[2-[2-(2-aminoethylamino)ethyl-[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]ethyl-[3-oxo-3-(2,2,4,4-tetramethylhexylamino)propyl]amino]-N-(2,2,4,4-tetramethylhexyl)propanamide (PubChem CID 90785659) has the molecular formula C44H91N7O3 and a molecular weight of 766.26 g/mol. Its IUPAC name is 3-[2-[2-(2-aminoethylamino)ethyl-[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]ethyl-[3-oxo-3-(2,2,4,4-tetramethylhexylamino)propyl]amino]-N-(2,2,4,4-tetramethylhexyl)propanamide.
| Compound Name | 3-[2-[2-(2-aminoethylamino)ethyl-[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]ethyl-[3-oxo-3-(2,2,4,4-tetramethylhexylamino)propyl]amino]-N-(2,2,4,4-tetramethylhexyl)propanamide |
|---|---|
| PubChem CID | 90785659 |
| Molecular Formula | C44H91N7O3 |
| Molecular Weight | 766.26 g/mol |
| Exact Mass | 765.72 |
| IUPAC Name | 3-[2-[2-(2-aminoethylamino)ethyl-[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]ethyl-[3-oxo-3-(2,2,4,4-tetramethylhexylamino)propyl]amino]-N-(2,2,4,4-tetramethylhexyl)propanamide |
| SMILES | CCC(C)(C)CC(C)(C)CNC(=O)CCN(CCC(=O)NCC(C)(C)CC(C)(C)CC)CCN(CCNCCN)CCC(=O)NCC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C44H91N7O3/c1-16-40(6,7)31-43(12,13)34-48-36(52)18-24-50(25-19-37(53)49-35-44(14,15)32-41(8,9)17-2)28-29-51(27-23-46-22-21-45)26-20-38(54)47-33-42(10,11)30-39(3,4)5/h46H,16-35,45H2,1-15H3,(H,47,54)(H,48,52)(H,49,53) |
| InChIKey | VQZVLDPSQTUPIL-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.26 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|