1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid

C12H11N3O2 — CID 90787566

IUPAC1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid
SMILESO=C(O)N1Cc2cnn(-c3ccccc3)c2C1
InChIInChI=1S/C12H11N3O2/c16-12(17)14-7-9-6-13-15(11(9)8-14)10-4-2-1-3-5-10/h1-6H,7-8H2,(H,16,17)
InChIKeyUKTHXTGEWTUUGW-UHFFFAOYSA-N
MW229.24 g/mol
LogP1.87
Rot. Bonds1

About 1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid

1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid (PubChem CID 90787566) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid.

Molecular Properties

Compound Name1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid
PubChem CID90787566
Molecular FormulaC12H11N3O2
Molecular Weight229.24 g/mol
Exact Mass229.09
IUPAC Name1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid
SMILESO=C(O)N1Cc2cnn(-c3ccccc3)c2C1
InChIInChI=1S/C12H11N3O2/c16-12(17)14-7-9-6-13-15(11(9)8-14)10-4-2-1-3-5-10/h1-6H,7-8H2,(H,16,17)
InChIKeyUKTHXTGEWTUUGW-UHFFFAOYSA-N
XLogP1.87
TPSA58.36 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.24
LogP ≤ 51.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid?
The IUPAC name of 1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid (CID 90787566) is 1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid.
What is the SMILES notation for 1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid?
The canonical SMILES for 1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid is O=C(O)N1Cc2cnn(-c3ccccc3)c2C1.
What is the InChIKey of 1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid?
The InChIKey is UKTHXTGEWTUUGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O2/c16-12(17)14-7-9-6-13-15(11(9)8-14)10-4-2-1-3-5-10/h1-6H,7-8H2,(H,16,17).
What are the key properties of 1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid?
1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid has a molecular weight of 229.24 g/mol, XLogP of 1.87, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid is sourced from PubChem (CID 90787566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).