C16H14Cl2N4O3 — CID 90788011
6-(2,6-dichlorophenyl)-2-[ethyl(hydroxy)amino]-8-methoxypyrido[2,3-d]pyrimidin-7-one (PubChem CID 90788011) has the molecular formula C16H14Cl2N4O3 and a molecular weight of 381.22 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-2-[ethyl(hydroxy)amino]-8-methoxypyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2,6-dichlorophenyl)-2-[ethyl(hydroxy)amino]-8-methoxypyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 90788011 |
| Molecular Formula | C16H14Cl2N4O3 |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-2-[ethyl(hydroxy)amino]-8-methoxypyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCN(O)c1ncc2cc(-c3c(Cl)cccc3Cl)c(=O)n(OC)c2n1 |
| InChI | InChI=1S/C16H14Cl2N4O3/c1-3-21(24)16-19-8-9-7-10(13-11(17)5-4-6-12(13)18)15(23)22(25-2)14(9)20-16/h4-8,24H,3H2,1-2H3 |
| InChIKey | MSCIVJIGGYISGP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|