C25H30O5 — CID 90788609
[1-acetyloxy-2-ethyl-3-(4-phenylmethoxyphenyl)cyclohexyl] acetate (PubChem CID 90788609) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is [1-acetyloxy-2-ethyl-3-(4-phenylmethoxyphenyl)cyclohexyl] acetate.
| Compound Name | [1-acetyloxy-2-ethyl-3-(4-phenylmethoxyphenyl)cyclohexyl] acetate |
|---|---|
| PubChem CID | 90788609 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | [1-acetyloxy-2-ethyl-3-(4-phenylmethoxyphenyl)cyclohexyl] acetate |
| SMILES | CCC1C(c2ccc(OCc3ccccc3)cc2)CCCC1(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C25H30O5/c1-4-24-23(11-8-16-25(24,29-18(2)26)30-19(3)27)21-12-14-22(15-13-21)28-17-20-9-6-5-7-10-20/h5-7,9-10,12-15,23-24H,4,8,11,16-17H2,1-3H3 |
| InChIKey | FZUOVZAWHQKKCW-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|