C21H17NO5 — CID 9078864
(3S)-3-methyl-5-[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]-1,3-dihydroindol-2-one (PubChem CID 9078864) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is (3S)-3-methyl-5-[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]-1,3-dihydroindol-2-one.
| Compound Name | (3S)-3-methyl-5-[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 9078864 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (3S)-3-methyl-5-[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]-1,3-dihydroindol-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)c3ccc4c(c3)[C@H](C)C(=O)N4)ccc12 |
| InChI | InChI=1S/C21H17NO5/c1-11-7-20(24)27-19-9-14(4-5-15(11)19)26-10-18(23)13-3-6-17-16(8-13)12(2)21(25)22-17/h3-9,12H,10H2,1-2H3,(H,22,25)/t12-/m0/s1 |
| InChIKey | RYXUQXUZOIZMFZ-LBPRGKRZSA-N |
| XLogP | 3.42 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|