C31H27FN4O3S — CID 90789558
5-[2-(3-fluoro-2-phenylmethoxyphenyl)-4-methyl-6-oxo-1-(2-phenylethyl)pyrimidin-5-yl]-N'-hydroxythiophene-3-carboximidamide (PubChem CID 90789558) has the molecular formula C31H27FN4O3S and a molecular weight of 554.65 g/mol. Its IUPAC name is 5-[2-(3-fluoro-2-phenylmethoxyphenyl)-4-methyl-6-oxo-1-(2-phenylethyl)pyrimidin-5-yl]-N'-hydroxythiophene-3-carboximidamide.
| Compound Name | 5-[2-(3-fluoro-2-phenylmethoxyphenyl)-4-methyl-6-oxo-1-(2-phenylethyl)pyrimidin-5-yl]-N'-hydroxythiophene-3-carboximidamide |
|---|---|
| PubChem CID | 90789558 |
| Molecular Formula | C31H27FN4O3S |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | 5-[2-(3-fluoro-2-phenylmethoxyphenyl)-4-methyl-6-oxo-1-(2-phenylethyl)pyrimidin-5-yl]-N'-hydroxythiophene-3-carboximidamide |
| SMILES | Cc1nc(-c2cccc(F)c2OCc2ccccc2)n(CCc2ccccc2)c(=O)c1-c1cc(C(N)=NO)cs1 |
| InChI | InChI=1S/C31H27FN4O3S/c1-20-27(26-17-23(19-40-26)29(33)35-38)31(37)36(16-15-21-9-4-2-5-10-21)30(34-20)24-13-8-14-25(32)28(24)39-18-22-11-6-3-7-12-22/h2-14,17,19,38H,15-16,18H2,1H3,(H2,33,35) |
| InChIKey | FPHVKRDZQGDBKA-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|