C31H31FN4O7S — CID 91367076
[2-fluoro-6-[5-[4-[N'-(2-methoxyacetyl)oxycarbamimidoyl]-5-methylthiophen-2-yl]-4-methyl-6-oxo-1-(2-phenylethyl)pyrimidin-2-yl]phenyl] 2-methoxyacetate (PubChem CID 91367076) has the molecular formula C31H31FN4O7S and a molecular weight of 622.68 g/mol. Its IUPAC name is [2-fluoro-6-[5-[4-[N'-(2-methoxyacetyl)oxycarbamimidoyl]-5-methylthiophen-2-yl]-4-methyl-6-oxo-1-(2-phenylethyl)pyrimidin-2-yl]phenyl] 2-methoxyacetate.
| Compound Name | [2-fluoro-6-[5-[4-[N'-(2-methoxyacetyl)oxycarbamimidoyl]-5-methylthiophen-2-yl]-4-methyl-6-oxo-1-(2-phenylethyl)pyrimidin-2-yl]phenyl] 2-methoxyacetate |
|---|---|
| PubChem CID | 91367076 |
| Molecular Formula | C31H31FN4O7S |
| Molecular Weight | 622.68 g/mol |
| Exact Mass | 622.19 |
| IUPAC Name | [2-fluoro-6-[5-[4-[N'-(2-methoxyacetyl)oxycarbamimidoyl]-5-methylthiophen-2-yl]-4-methyl-6-oxo-1-(2-phenylethyl)pyrimidin-2-yl]phenyl] 2-methoxyacetate |
| SMILES | COCC(=O)ON=C(N)c1cc(-c2c(C)nc(-c3cccc(F)c3OC(=O)COC)n(CCc3ccccc3)c2=O)sc1C |
| InChI | InChI=1S/C31H31FN4O7S/c1-18-27(24-15-22(19(2)44-24)29(33)35-43-26(38)17-41-4)31(39)36(14-13-20-9-6-5-7-10-20)30(34-18)21-11-8-12-23(32)28(21)42-25(37)16-40-3/h5-12,15H,13-14,16-17H2,1-4H3,(H2,33,35) |
| InChIKey | DOZLWAYNLQZJDS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 144.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.68 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|