C13H24N2O — CID 90789858
2,6-diethyl-4-propylpyridazin-3-one;ethane (PubChem CID 90789858) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 2,6-diethyl-4-propylpyridazin-3-one;ethane.
| Compound Name | 2,6-diethyl-4-propylpyridazin-3-one;ethane |
|---|---|
| PubChem CID | 90789858 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 2,6-diethyl-4-propylpyridazin-3-one;ethane |
| SMILES | CC.CCCc1cc(CC)nn(CC)c1=O |
| InChI | InChI=1S/C11H18N2O.C2H6/c1-4-7-9-8-10(5-2)12-13(6-3)11(9)14;1-2/h8H,4-7H2,1-3H3;1-2H3 |
| InChIKey | FSTTVDJVNKSHKC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |