C8H12N2O — CID 59120442
4-ethyl-2,6-dimethylpyridazin-3-one (PubChem CID 59120442) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is 4-ethyl-2,6-dimethylpyridazin-3-one.
| Compound Name | 4-ethyl-2,6-dimethylpyridazin-3-one |
|---|---|
| PubChem CID | 59120442 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 4-ethyl-2,6-dimethylpyridazin-3-one |
| SMILES | CCc1cc(C)nn(C)c1=O |
| InChI | InChI=1S/C8H12N2O/c1-4-7-5-6(2)9-10(3)8(7)11/h5H,4H2,1-3H3 |
| InChIKey | GMGBRUUNIXMWME-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |