C7H10N2O — CID 22950815
4-ethylidene-2,5-dimethylpyrazol-3-one (PubChem CID 22950815) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is 4-ethylidene-2,5-dimethylpyrazol-3-one.
| Compound Name | 4-ethylidene-2,5-dimethylpyrazol-3-one |
|---|---|
| PubChem CID | 22950815 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 4-ethylidene-2,5-dimethylpyrazol-3-one |
| SMILES | CC=C1C(=O)N(C)N=C1C |
| InChI | InChI=1S/C7H10N2O/c1-4-6-5(2)8-9(3)7(6)10/h4H,1-3H3 |
| InChIKey | TVUFKWORVSNCHE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|