C8H9N2OY- — CID 59872787
2,5-dimethyl-4-prop-2-enylidenepyrazol-3-one;yttrium (PubChem CID 59872787) has the molecular formula C8H9N2OY- and a molecular weight of 238.08 g/mol. Its IUPAC name is 2,5-dimethyl-4-prop-2-enylidenepyrazol-3-one;yttrium.
| Compound Name | 2,5-dimethyl-4-prop-2-enylidenepyrazol-3-one;yttrium |
|---|---|
| PubChem CID | 59872787 |
| Molecular Formula | C8H9N2OY- |
| Molecular Weight | 238.08 g/mol |
| Exact Mass | 237.98 |
| IUPAC Name | 2,5-dimethyl-4-prop-2-enylidenepyrazol-3-one;yttrium |
| SMILES | [H]/[C-]=C\C=C1C(=O)N(C)N=C1C.[Y] |
| InChI | InChI=1S/C8H9N2O.Y/c1-4-5-7-6(2)9-10(3)8(7)11;/h1,4-5H,2-3H3;/q-1; |
| InChIKey | FNOASZXXJFFLGY-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.08 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|