C11H14N2O — CID 91019027
1,3-dimethyl-7H-cyclopenta[d]pyridazin-4-one;ethene (PubChem CID 91019027) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 1,3-dimethyl-7H-cyclopenta[d]pyridazin-4-one;ethene.
| Compound Name | 1,3-dimethyl-7H-cyclopenta[d]pyridazin-4-one;ethene |
|---|---|
| PubChem CID | 91019027 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 1,3-dimethyl-7H-cyclopenta[d]pyridazin-4-one;ethene |
| SMILES | C=C.Cc1nn(C)c(=O)c2c1CC=C2 |
| InChI | InChI=1S/C9H10N2O.C2H4/c1-6-7-4-3-5-8(7)9(12)11(2)10-6;1-2/h3,5H,4H2,1-2H3;1-2H2 |
| InChIKey | IUMHQPVJMJEPSO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|