C12H18N2O — CID 59887615
(4E)-4-(3,4-dimethylpent-3-en-2-ylidene)-2,5-dimethylpyrazol-3-one (PubChem CID 59887615) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is (4E)-4-(3,4-dimethylpent-3-en-2-ylidene)-2,5-dimethylpyrazol-3-one.
| Compound Name | (4E)-4-(3,4-dimethylpent-3-en-2-ylidene)-2,5-dimethylpyrazol-3-one |
|---|---|
| PubChem CID | 59887615 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (4E)-4-(3,4-dimethylpent-3-en-2-ylidene)-2,5-dimethylpyrazol-3-one |
| SMILES | CC1=NN(C)C(=O)/C1=C(\C)C(C)=C(C)C |
| InChI | InChI=1S/C12H18N2O/c1-7(2)8(3)9(4)11-10(5)13-14(6)12(11)15/h1-6H3/b11-9+ |
| InChIKey | LVWJUTWQNJETNZ-PKNBQFBNSA-N |
| XLogP | 2.51 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|