About 4-ethylidene-2,5-dimethylpyrazol-3-one;yttrium(3+)
4-ethylidene-2,5-dimethylpyrazol-3-one;yttrium(3+) (PubChem CID 22950814) has the molecular formula C7H9N2OY+2
and a molecular weight of 226.07 g/mol. Its IUPAC name is 4-ethylidene-2,5-dimethylpyrazol-3-one;yttrium(3+).
Molecular Properties
| Compound Name | 4-ethylidene-2,5-dimethylpyrazol-3-one;yttrium(3+) |
| PubChem CID | 22950814 |
| Molecular Formula | C7H9N2OY+2 |
| Molecular Weight | 226.07 g/mol |
| Exact Mass | 225.98 |
| IUPAC Name | 4-ethylidene-2,5-dimethylpyrazol-3-one;yttrium(3+) |
| SMILES | C/[C-]=C1\C(=O)N(C)N=C1C.[Y+3] |
| InChI | InChI=1S/C7H9N2O.Y/c1-4-6-5(2)8-9(3)7(6)10;/h1-3H3;/q-1;+3 |
| InChIKey | ZBQOEWXVCLKUDK-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.07 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylidene-2,5-dimethylpyrazol-3-one;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylidene-2,5-dimethylpyrazol-3-one;yttrium(3+)?
The IUPAC name of 4-ethylidene-2,5-dimethylpyrazol-3-one;yttrium(3+) (CID 22950814) is 4-ethylidene-2,5-dimethylpyrazol-3-one;yttrium(3+).
What is the SMILES notation for 4-ethylidene-2,5-dimethylpyrazol-3-one;yttrium(3+)?
The canonical SMILES for 4-ethylidene-2,5-dimethylpyrazol-3-one;yttrium(3+) is C/[C-]=C1\C(=O)N(C)N=C1C.[Y+3].
What is the InChIKey of 4-ethylidene-2,5-dimethylpyrazol-3-one;yttrium(3+)?
The InChIKey is ZBQOEWXVCLKUDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N2O.Y/c1-4-6-5(2)8-9(3)7(6)10;/h1-3H3;/q-1;+3.
What are the key properties of 4-ethylidene-2,5-dimethylpyrazol-3-one;yttrium(3+)?
4-ethylidene-2,5-dimethylpyrazol-3-one;yttrium(3+) has a molecular weight of 226.07 g/mol, XLogP of 0.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylidene-2,5-dimethylpyrazol-3-one;yttrium(3+) is sourced from PubChem (CID 22950814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).