C18H26N2 — CID 90790554
N-(1,2,3,3a,5,6,7,7a-octahydroinden-4-ylideneamino)-1,2,3,3a,5,6-hexahydroinden-4-imine (PubChem CID 90790554) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is N-(1,2,3,3a,5,6,7,7a-octahydroinden-4-ylideneamino)-1,2,3,3a,5,6-hexahydroinden-4-imine.
| Compound Name | N-(1,2,3,3a,5,6,7,7a-octahydroinden-4-ylideneamino)-1,2,3,3a,5,6-hexahydroinden-4-imine |
|---|---|
| PubChem CID | 90790554 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N-(1,2,3,3a,5,6,7,7a-octahydroinden-4-ylideneamino)-1,2,3,3a,5,6-hexahydroinden-4-imine |
| SMILES | C1=C2CCCC2C(=NN=C2CCCC3CCCC23)CC1 |
| InChI | InChI=1S/C18H26N2/c1-5-13-7-3-11-17(15(13)9-1)19-20-18-12-4-8-14-6-2-10-16(14)18/h7,14-16H,1-6,8-12H2 |
| InChIKey | NFVXLBVJGDHQPX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|