C17H23N3O — CID 90790732
3,5-dipyridin-3-yl-4,5-dihydro-1,2-oxazole;ethane (PubChem CID 90790732) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 3,5-dipyridin-3-yl-4,5-dihydro-1,2-oxazole;ethane.
| Compound Name | 3,5-dipyridin-3-yl-4,5-dihydro-1,2-oxazole;ethane |
|---|---|
| PubChem CID | 90790732 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 3,5-dipyridin-3-yl-4,5-dihydro-1,2-oxazole;ethane |
| SMILES | CC.CC.c1cncc(C2=NOC(c3cccnc3)C2)c1 |
| InChI | InChI=1S/C13H11N3O.2C2H6/c1-3-10(8-14-5-1)12-7-13(17-16-12)11-4-2-6-15-9-11;2*1-2/h1-6,8-9,13H,7H2;2*1-2H3 |
| InChIKey | FWONYSRTYUISEC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 47.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |