C25H28F3N3O4S — CID 90791036
3-amino-N-[4-[6-(2-methoxyethoxy)-1,3-benzothiazol-2-yl]oxan-4-yl]-4-(2,4,5-trifluorophenyl)butanamide (PubChem CID 90791036) has the molecular formula C25H28F3N3O4S and a molecular weight of 523.58 g/mol. Its IUPAC name is 3-amino-N-[4-[6-(2-methoxyethoxy)-1,3-benzothiazol-2-yl]oxan-4-yl]-4-(2,4,5-trifluorophenyl)butanamide.
| Compound Name | 3-amino-N-[4-[6-(2-methoxyethoxy)-1,3-benzothiazol-2-yl]oxan-4-yl]-4-(2,4,5-trifluorophenyl)butanamide |
|---|---|
| PubChem CID | 90791036 |
| Molecular Formula | C25H28F3N3O4S |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | 3-amino-N-[4-[6-(2-methoxyethoxy)-1,3-benzothiazol-2-yl]oxan-4-yl]-4-(2,4,5-trifluorophenyl)butanamide |
| SMILES | COCCOc1ccc2nc(C3(NC(=O)CC(N)Cc4cc(F)c(F)cc4F)CCOCC3)sc2c1 |
| InChI | InChI=1S/C25H28F3N3O4S/c1-33-8-9-35-17-2-3-21-22(13-17)36-24(30-21)25(4-6-34-7-5-25)31-23(32)12-16(29)10-15-11-19(27)20(28)14-18(15)26/h2-3,11,13-14,16H,4-10,12,29H2,1H3,(H,31,32) |
| InChIKey | CHOHYHSFVOBJFY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|