C21H20F3N3O5 — CID 90791877
N-(4-ethanimidoylphenyl)-2-hydroxy-2-[3-oxo-4-[3-(trifluoromethoxy)phenyl]morpholin-2-yl]acetamide (PubChem CID 90791877) has the molecular formula C21H20F3N3O5 and a molecular weight of 451.40 g/mol. Its IUPAC name is N-(4-ethanimidoylphenyl)-2-hydroxy-2-[3-oxo-4-[3-(trifluoromethoxy)phenyl]morpholin-2-yl]acetamide.
| Compound Name | N-(4-ethanimidoylphenyl)-2-hydroxy-2-[3-oxo-4-[3-(trifluoromethoxy)phenyl]morpholin-2-yl]acetamide |
|---|---|
| PubChem CID | 90791877 |
| Molecular Formula | C21H20F3N3O5 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-(4-ethanimidoylphenyl)-2-hydroxy-2-[3-oxo-4-[3-(trifluoromethoxy)phenyl]morpholin-2-yl]acetamide |
| SMILES | [H]/N=C(\C)c1ccc(NC(=O)C(O)C2OCCN(c3cccc(OC(F)(F)F)c3)C2=O)cc1 |
| InChI | InChI=1S/C21H20F3N3O5/c1-12(25)13-5-7-14(8-6-13)26-19(29)17(28)18-20(30)27(9-10-31-18)15-3-2-4-16(11-15)32-21(22,23)24/h2-8,11,17-18,25,28H,9-10H2,1H3,(H,26,29)/b25-12+ |
| InChIKey | OBRGSRVSINTCII-BRJLIKDPSA-N |
| XLogP | 2.70 |
| TPSA | 111.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|