C42H48N6O4 — CID 90792711
2-[[3-[2-[3-[(2-hydroxy-3-methoxy-5-quinolin-3-ylphenyl)methylamino]propylamino]ethylamino]propylamino]methyl]-6-methoxy-4-quinolin-3-ylphenol (PubChem CID 90792711) has the molecular formula C42H48N6O4 and a molecular weight of 700.88 g/mol. Its IUPAC name is 2-[[3-[2-[3-[(2-hydroxy-3-methoxy-5-quinolin-3-ylphenyl)methylamino]propylamino]ethylamino]propylamino]methyl]-6-methoxy-4-quinolin-3-ylphenol.
| Compound Name | 2-[[3-[2-[3-[(2-hydroxy-3-methoxy-5-quinolin-3-ylphenyl)methylamino]propylamino]ethylamino]propylamino]methyl]-6-methoxy-4-quinolin-3-ylphenol |
|---|---|
| PubChem CID | 90792711 |
| Molecular Formula | C42H48N6O4 |
| Molecular Weight | 700.88 g/mol |
| Exact Mass | 700.37 |
| IUPAC Name | 2-[[3-[2-[3-[(2-hydroxy-3-methoxy-5-quinolin-3-ylphenyl)methylamino]propylamino]ethylamino]propylamino]methyl]-6-methoxy-4-quinolin-3-ylphenol |
| SMILES | COc1cc(-c2cnc3ccccc3c2)cc(CNCCCNCCNCCCNCc2cc(-c3cnc4ccccc4c3)cc(OC)c2O)c1O |
| InChI | InChI=1S/C42H48N6O4/c1-51-39-23-31(33-19-29-9-3-5-11-37(29)47-27-33)21-35(41(39)49)25-45-15-7-13-43-17-18-44-14-8-16-46-26-36-22-32(24-40(52-2)42(36)50)34-20-30-10-4-6-12-38(30)48-28-34/h3-6,9-12,19-24,27-28,43-46,49-50H,7-8,13-18,25-26H2,1-2H3 |
| InChIKey | TWILNXJAUYOLLG-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 132.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.88 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|