C8H14N2O4S — CID 90793042
3-[(2R)-2-amino-3-hydroperoxypropyl]sulfanyl-1-methylpyrrole-2,5-diol (PubChem CID 90793042) has the molecular formula C8H14N2O4S and a molecular weight of 234.28 g/mol. Its IUPAC name is 3-[(2R)-2-amino-3-hydroperoxypropyl]sulfanyl-1-methylpyrrole-2,5-diol.
| Compound Name | 3-[(2R)-2-amino-3-hydroperoxypropyl]sulfanyl-1-methylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 90793042 |
| Molecular Formula | C8H14N2O4S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 3-[(2R)-2-amino-3-hydroperoxypropyl]sulfanyl-1-methylpyrrole-2,5-diol |
| SMILES | Cn1c(O)cc(SC[C@H](N)COO)c1O |
| InChI | InChI=1S/C8H14N2O4S/c1-10-7(11)2-6(8(10)12)15-4-5(9)3-14-13/h2,5,11-13H,3-4,9H2,1H3/t5-/m1/s1 |
| InChIKey | HXABEJXVPWNGQP-RXMQYKEDSA-N |
| XLogP | 0.35 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|