C7H14N2 — CID 90793839
2-ethyl-2,3-dimethyl-4H-imidazole (PubChem CID 90793839) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is 2-ethyl-2,3-dimethyl-4H-imidazole.
| Compound Name | 2-ethyl-2,3-dimethyl-4H-imidazole |
|---|---|
| PubChem CID | 90793839 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 2-ethyl-2,3-dimethyl-4H-imidazole |
| SMILES | CCC1(C)N=CCN1C |
| InChI | InChI=1S/C7H14N2/c1-4-7(2)8-5-6-9(7)3/h5H,4,6H2,1-3H3 |
| InChIKey | ZZIGBCIXJCQQBP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |