C17H15F2NO — CID 90794714
2-[3-(2,4-difluorophenyl)propyl]isoindol-1-ol (PubChem CID 90794714) has the molecular formula C17H15F2NO and a molecular weight of 287.31 g/mol. Its IUPAC name is 2-[3-(2,4-difluorophenyl)propyl]isoindol-1-ol.
| Compound Name | 2-[3-(2,4-difluorophenyl)propyl]isoindol-1-ol |
|---|---|
| PubChem CID | 90794714 |
| Molecular Formula | C17H15F2NO |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-[3-(2,4-difluorophenyl)propyl]isoindol-1-ol |
| SMILES | Oc1c2ccccc2cn1CCCc1ccc(F)cc1F |
| InChI | InChI=1S/C17H15F2NO/c18-14-8-7-12(16(19)10-14)5-3-9-20-11-13-4-1-2-6-15(13)17(20)21/h1-2,4,6-8,10-11,21H,3,5,9H2 |
| InChIKey | IFJSQEWFNUTNJR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |