C31H33N3O4 — CID 90796201
3-[14-hydroxy-7-(propan-2-yloxymethyl)-3,13-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4(9),5,7,11,14,17,19,21-decaen-3-yl]propyl 3-aminopropanoate (PubChem CID 90796201) has the molecular formula C31H33N3O4 and a molecular weight of 511.62 g/mol. Its IUPAC name is 3-[14-hydroxy-7-(propan-2-yloxymethyl)-3,13-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4(9),5,7,11,14,17,19,21-decaen-3-yl]propyl 3-aminopropanoate.
| Compound Name | 3-[14-hydroxy-7-(propan-2-yloxymethyl)-3,13-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4(9),5,7,11,14,17,19,21-decaen-3-yl]propyl 3-aminopropanoate |
|---|---|
| PubChem CID | 90796201 |
| Molecular Formula | C31H33N3O4 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | 3-[14-hydroxy-7-(propan-2-yloxymethyl)-3,13-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4(9),5,7,11,14,17,19,21-decaen-3-yl]propyl 3-aminopropanoate |
| SMILES | CC(C)OCc1ccc2c(c1)c1c3c[nH]c(O)c3c3c(c1n2CCCOC(=O)CCN)Cc1ccccc1-3 |
| InChI | InChI=1S/C31H33N3O4/c1-18(2)38-17-19-8-9-25-22(14-19)28-24-16-33-31(36)29(24)27-21-7-4-3-6-20(21)15-23(27)30(28)34(25)12-5-13-37-26(35)10-11-32/h3-4,6-9,14,16,18,33,36H,5,10-13,15,17,32H2,1-2H3 |
| InChIKey | RIEISZITBWAEMW-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|