C22H24N4O2 — CID 90799678
2-[3-(2,2-dimethoxyethylimino)-1-[6-(dimethylamino)naphthalen-2-yl]propylidene]propanedinitrile (PubChem CID 90799678) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-[3-(2,2-dimethoxyethylimino)-1-[6-(dimethylamino)naphthalen-2-yl]propylidene]propanedinitrile.
| Compound Name | 2-[3-(2,2-dimethoxyethylimino)-1-[6-(dimethylamino)naphthalen-2-yl]propylidene]propanedinitrile |
|---|---|
| PubChem CID | 90799678 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2-[3-(2,2-dimethoxyethylimino)-1-[6-(dimethylamino)naphthalen-2-yl]propylidene]propanedinitrile |
| SMILES | COC(C/N=C/CC(=C(C#N)C#N)c1ccc2cc(N(C)C)ccc2c1)OC |
| InChI | InChI=1S/C22H24N4O2/c1-26(2)20-8-7-16-11-18(6-5-17(16)12-20)21(19(13-23)14-24)9-10-25-15-22(27-3)28-4/h5-8,10-12,22H,9,15H2,1-4H3/b25-10+ |
| InChIKey | OWLINOONOMJLHH-KIBLKLHPSA-N |
| XLogP | 3.79 |
| TPSA | 81.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|