C28H39NO5 — CID 90800659
methoxymethylbenzene;methyl 3-[[2-(hydroxymethyl)-2-phenylpent-4-enoyl]amino]-2,2,3-trimethylbutanoate (PubChem CID 90800659) has the molecular formula C28H39NO5 and a molecular weight of 469.62 g/mol. Its IUPAC name is methoxymethylbenzene;methyl 3-[[2-(hydroxymethyl)-2-phenylpent-4-enoyl]amino]-2,2,3-trimethylbutanoate.
| Compound Name | methoxymethylbenzene;methyl 3-[[2-(hydroxymethyl)-2-phenylpent-4-enoyl]amino]-2,2,3-trimethylbutanoate |
|---|---|
| PubChem CID | 90800659 |
| Molecular Formula | C28H39NO5 |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | methoxymethylbenzene;methyl 3-[[2-(hydroxymethyl)-2-phenylpent-4-enoyl]amino]-2,2,3-trimethylbutanoate |
| SMILES | C=CCC(CO)(C(=O)NC(C)(C)C(C)(C)C(=O)OC)c1ccccc1.COCc1ccccc1 |
| InChI | InChI=1S/C20H29NO4.C8H10O/c1-7-13-20(14-22,15-11-9-8-10-12-15)16(23)21-19(4,5)18(2,3)17(24)25-6;1-9-7-8-5-3-2-4-6-8/h7-12,22H,1,13-14H2,2-6H3,(H,21,23);2-6H,7H2,1H3 |
| InChIKey | XEINETRAQBQZSC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|