C20H29NO4 — CID 59887350
methyl 3-[[2-(hydroxymethyl)-2-phenylpent-4-enoyl]amino]-2,2,3-trimethylbutanoate (PubChem CID 59887350) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is methyl 3-[[2-(hydroxymethyl)-2-phenylpent-4-enoyl]amino]-2,2,3-trimethylbutanoate.
| Compound Name | methyl 3-[[2-(hydroxymethyl)-2-phenylpent-4-enoyl]amino]-2,2,3-trimethylbutanoate |
|---|---|
| PubChem CID | 59887350 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | methyl 3-[[2-(hydroxymethyl)-2-phenylpent-4-enoyl]amino]-2,2,3-trimethylbutanoate |
| SMILES | C=CCC(CO)(C(=O)NC(C)(C)C(C)(C)C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C20H29NO4/c1-7-13-20(14-22,15-11-9-8-10-12-15)16(23)21-19(4,5)18(2,3)17(24)25-6/h7-12,22H,1,13-14H2,2-6H3,(H,21,23) |
| InChIKey | KKGIIHJQWCGFBO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|